C13H15N3O2S2 — CID 63922199
4-(1,1-dioxothian-3-yl)-3-phenyl-1H-1,2,4-triazole-5-thione (PubChem CID 63922199) has the molecular formula C13H15N3O2S2 and a molecular weight of 309.42 g/mol. Its IUPAC name is 4-(1,1-dioxothian-3-yl)-3-phenyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(1,1-dioxothian-3-yl)-3-phenyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 63922199 |
| Molecular Formula | C13H15N3O2S2 |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 4-(1,1-dioxothian-3-yl)-3-phenyl-1H-1,2,4-triazole-5-thione |
| SMILES | O=S1(=O)CCCC(n2c(-c3ccccc3)n[nH]c2=S)C1 |
| InChI | InChI=1S/C13H15N3O2S2/c17-20(18)8-4-7-11(9-20)16-12(14-15-13(16)19)10-5-2-1-3-6-10/h1-3,5-6,11H,4,7-9H2,(H,15,19) |
| InChIKey | YKZUFNLMLDWYCS-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|