C14H30N2O2S — CID 63922457
3-(aminomethyl)-N-butan-2-yl-N-butyl-1,1-dioxothian-3-amine (PubChem CID 63922457) has the molecular formula C14H30N2O2S and a molecular weight of 290.47 g/mol. Its IUPAC name is 3-(aminomethyl)-N-butan-2-yl-N-butyl-1,1-dioxothian-3-amine.
| Compound Name | 3-(aminomethyl)-N-butan-2-yl-N-butyl-1,1-dioxothian-3-amine |
|---|---|
| PubChem CID | 63922457 |
| Molecular Formula | C14H30N2O2S |
| Molecular Weight | 290.47 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 3-(aminomethyl)-N-butan-2-yl-N-butyl-1,1-dioxothian-3-amine |
| SMILES | CCCCN(C(C)CC)C1(CN)CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H30N2O2S/c1-4-6-9-16(13(3)5-2)14(11-15)8-7-10-19(17,18)12-14/h13H,4-12,15H2,1-3H3 |
| InChIKey | VGOIGPHHLSMHJQ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.47 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |