C13H22N2O3S2 — CID 63922480
3-(4,5-dimethyl-1,3-thiazol-2-yl)-N-(2-methoxyethyl)-1,1-dioxothian-3-amine (PubChem CID 63922480) has the molecular formula C13H22N2O3S2 and a molecular weight of 318.46 g/mol. Its IUPAC name is 3-(4,5-dimethyl-1,3-thiazol-2-yl)-N-(2-methoxyethyl)-1,1-dioxothian-3-amine.
| Compound Name | 3-(4,5-dimethyl-1,3-thiazol-2-yl)-N-(2-methoxyethyl)-1,1-dioxothian-3-amine |
|---|---|
| PubChem CID | 63922480 |
| Molecular Formula | C13H22N2O3S2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 3-(4,5-dimethyl-1,3-thiazol-2-yl)-N-(2-methoxyethyl)-1,1-dioxothian-3-amine |
| SMILES | COCCNC1(c2nc(C)c(C)s2)CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H22N2O3S2/c1-10-11(2)19-12(15-10)13(14-6-7-18-3)5-4-8-20(16,17)9-13/h14H,4-9H2,1-3H3 |
| InChIKey | ARXCBWIZSSDRAZ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|