About 1-(1,1-dioxothian-3-yl)-2-sulfanylidenepyrimidin-4-one
1-(1,1-dioxothian-3-yl)-2-sulfanylidenepyrimidin-4-one (PubChem CID 63922796) has the molecular formula C9H12N2O3S2
and a molecular weight of 260.34 g/mol. Its IUPAC name is 1-(1,1-dioxothian-3-yl)-2-sulfanylidenepyrimidin-4-one.
Molecular Properties
| Compound Name | 1-(1,1-dioxothian-3-yl)-2-sulfanylidenepyrimidin-4-one |
| PubChem CID | 63922796 |
| Molecular Formula | C9H12N2O3S2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | 1-(1,1-dioxothian-3-yl)-2-sulfanylidenepyrimidin-4-one |
| SMILES | O=c1ccn(C2CCCS(=O)(=O)C2)c(=S)[nH]1 |
| InChI | InChI=1S/C9H12N2O3S2/c12-8-3-4-11(9(15)10-8)7-2-1-5-16(13,14)6-7/h3-4,7H,1-2,5-6H2,(H,10,12,15) |
| InChIKey | RNGJVVFXDLISHS-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,1-dioxothian-3-yl)-2-sulfanylidenepyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,1-dioxothian-3-yl)-2-sulfanylidenepyrimidin-4-one?
The IUPAC name of 1-(1,1-dioxothian-3-yl)-2-sulfanylidenepyrimidin-4-one (CID 63922796) is 1-(1,1-dioxothian-3-yl)-2-sulfanylidenepyrimidin-4-one.
What is the SMILES notation for 1-(1,1-dioxothian-3-yl)-2-sulfanylidenepyrimidin-4-one?
The canonical SMILES for 1-(1,1-dioxothian-3-yl)-2-sulfanylidenepyrimidin-4-one is O=c1ccn(C2CCCS(=O)(=O)C2)c(=S)[nH]1.
What is the InChIKey of 1-(1,1-dioxothian-3-yl)-2-sulfanylidenepyrimidin-4-one?
The InChIKey is RNGJVVFXDLISHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O3S2/c12-8-3-4-11(9(15)10-8)7-2-1-5-16(13,14)6-7/h3-4,7H,1-2,5-6H2,(H,10,12,15).
What are the key properties of 1-(1,1-dioxothian-3-yl)-2-sulfanylidenepyrimidin-4-one?
1-(1,1-dioxothian-3-yl)-2-sulfanylidenepyrimidin-4-one has a molecular weight of 260.34 g/mol, XLogP of 0.66, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,1-dioxothian-3-yl)-2-sulfanylidenepyrimidin-4-one is sourced from PubChem (CID 63922796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).