About 1-chloro-N-(1,1-dioxothian-3-yl)methanesulfonamide
1-chloro-N-(1,1-dioxothian-3-yl)methanesulfonamide (PubChem CID 63923007) has the molecular formula C6H12ClNO4S2
and a molecular weight of 261.75 g/mol. Its IUPAC name is 1-chloro-N-(1,1-dioxothian-3-yl)methanesulfonamide.
Molecular Properties
| Compound Name | 1-chloro-N-(1,1-dioxothian-3-yl)methanesulfonamide |
| PubChem CID | 63923007 |
| Molecular Formula | C6H12ClNO4S2 |
| Molecular Weight | 261.75 g/mol |
| Exact Mass | 260.99 |
| IUPAC Name | 1-chloro-N-(1,1-dioxothian-3-yl)methanesulfonamide |
| SMILES | O=S1(=O)CCCC(NS(=O)(=O)CCl)C1 |
| InChI | InChI=1S/C6H12ClNO4S2/c7-5-14(11,12)8-6-2-1-3-13(9,10)4-6/h6,8H,1-5H2 |
| InChIKey | STDBIOBULQMITK-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.75 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-N-(1,1-dioxothian-3-yl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-N-(1,1-dioxothian-3-yl)methanesulfonamide?
The IUPAC name of 1-chloro-N-(1,1-dioxothian-3-yl)methanesulfonamide (CID 63923007) is 1-chloro-N-(1,1-dioxothian-3-yl)methanesulfonamide.
What is the SMILES notation for 1-chloro-N-(1,1-dioxothian-3-yl)methanesulfonamide?
The canonical SMILES for 1-chloro-N-(1,1-dioxothian-3-yl)methanesulfonamide is O=S1(=O)CCCC(NS(=O)(=O)CCl)C1.
What is the InChIKey of 1-chloro-N-(1,1-dioxothian-3-yl)methanesulfonamide?
The InChIKey is STDBIOBULQMITK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12ClNO4S2/c7-5-14(11,12)8-6-2-1-3-13(9,10)4-6/h6,8H,1-5H2.
What are the key properties of 1-chloro-N-(1,1-dioxothian-3-yl)methanesulfonamide?
1-chloro-N-(1,1-dioxothian-3-yl)methanesulfonamide has a molecular weight of 261.75 g/mol, XLogP of -0.32, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-N-(1,1-dioxothian-3-yl)methanesulfonamide is sourced from PubChem (CID 63923007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).