About [(Z)-1,2-diphenylethylideneamino] benzoate
[(Z)-1,2-diphenylethylideneamino] benzoate (PubChem CID 6392325) has the molecular formula C21H17NO2
and a molecular weight of 315.37 g/mol. Its IUPAC name is [(Z)-1,2-diphenylethylideneamino] benzoate.
Molecular Properties
| Compound Name | [(Z)-1,2-diphenylethylideneamino] benzoate |
| PubChem CID | 6392325 |
| Molecular Formula | C21H17NO2 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | [(Z)-1,2-diphenylethylideneamino] benzoate |
| SMILES | O=C(O/N=C(/Cc1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H17NO2/c23-21(19-14-8-3-9-15-19)24-22-20(18-12-6-2-7-13-18)16-17-10-4-1-5-11-17/h1-15H,16H2/b22-20- |
| InChIKey | DZPXNVNSHUXZGC-XDOYNYLZSA-N |
| XLogP | 4.49 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-1,2-diphenylethylideneamino] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-1,2-diphenylethylideneamino] benzoate?
The IUPAC name of [(Z)-1,2-diphenylethylideneamino] benzoate (CID 6392325) is [(Z)-1,2-diphenylethylideneamino] benzoate.
What is the SMILES notation for [(Z)-1,2-diphenylethylideneamino] benzoate?
The canonical SMILES for [(Z)-1,2-diphenylethylideneamino] benzoate is O=C(O/N=C(/Cc1ccccc1)c1ccccc1)c1ccccc1.
What is the InChIKey of [(Z)-1,2-diphenylethylideneamino] benzoate?
The InChIKey is DZPXNVNSHUXZGC-XDOYNYLZSA-N. The full InChI is InChI=1S/C21H17NO2/c23-21(19-14-8-3-9-15-19)24-22-20(18-12-6-2-7-13-18)16-17-10-4-1-5-11-17/h1-15H,16H2/b22-20-.
What are the key properties of [(Z)-1,2-diphenylethylideneamino] benzoate?
[(Z)-1,2-diphenylethylideneamino] benzoate has a molecular weight of 315.37 g/mol, XLogP of 4.49, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-1,2-diphenylethylideneamino] benzoate is sourced from PubChem (CID 6392325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).