C8H13F3N2O3S — CID 63923262
1,1-dioxo-3-(2,2,2-trifluoroethylamino)thiane-3-carboxamide (PubChem CID 63923262) has the molecular formula C8H13F3N2O3S and a molecular weight of 274.26 g/mol. Its IUPAC name is 1,1-dioxo-3-(2,2,2-trifluoroethylamino)thiane-3-carboxamide.
| Compound Name | 1,1-dioxo-3-(2,2,2-trifluoroethylamino)thiane-3-carboxamide |
|---|---|
| PubChem CID | 63923262 |
| Molecular Formula | C8H13F3N2O3S |
| Molecular Weight | 274.26 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 1,1-dioxo-3-(2,2,2-trifluoroethylamino)thiane-3-carboxamide |
| SMILES | NC(=O)C1(NCC(F)(F)F)CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H13F3N2O3S/c9-8(10,11)4-13-7(6(12)14)2-1-3-17(15,16)5-7/h13H,1-5H2,(H2,12,14) |
| InChIKey | NQCSAEZYFRFERH-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.26 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |