About 6-bromo-3-(1,1-dioxothian-3-yl)-1H-benzimidazole-2-thione
6-bromo-3-(1,1-dioxothian-3-yl)-1H-benzimidazole-2-thione (PubChem CID 63923374) has the molecular formula C12H13BrN2O2S2
and a molecular weight of 361.29 g/mol. Its IUPAC name is 6-bromo-3-(1,1-dioxothian-3-yl)-1H-benzimidazole-2-thione.
Molecular Properties
| Compound Name | 6-bromo-3-(1,1-dioxothian-3-yl)-1H-benzimidazole-2-thione |
| PubChem CID | 63923374 |
| Molecular Formula | C12H13BrN2O2S2 |
| Molecular Weight | 361.29 g/mol |
| Exact Mass | 359.96 |
| IUPAC Name | 6-bromo-3-(1,1-dioxothian-3-yl)-1H-benzimidazole-2-thione |
| SMILES | O=S1(=O)CCCC(n2c(=S)[nH]c3cc(Br)ccc32)C1 |
| InChI | InChI=1S/C12H13BrN2O2S2/c13-8-3-4-11-10(6-8)14-12(18)15(11)9-2-1-5-19(16,17)7-9/h3-4,6,9H,1-2,5,7H2,(H,14,18) |
| InChIKey | DUNVZXBCSSYLSU-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.29 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-3-(1,1-dioxothian-3-yl)-1H-benzimidazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-3-(1,1-dioxothian-3-yl)-1H-benzimidazole-2-thione?
The IUPAC name of 6-bromo-3-(1,1-dioxothian-3-yl)-1H-benzimidazole-2-thione (CID 63923374) is 6-bromo-3-(1,1-dioxothian-3-yl)-1H-benzimidazole-2-thione.
What is the SMILES notation for 6-bromo-3-(1,1-dioxothian-3-yl)-1H-benzimidazole-2-thione?
The canonical SMILES for 6-bromo-3-(1,1-dioxothian-3-yl)-1H-benzimidazole-2-thione is O=S1(=O)CCCC(n2c(=S)[nH]c3cc(Br)ccc32)C1.
What is the InChIKey of 6-bromo-3-(1,1-dioxothian-3-yl)-1H-benzimidazole-2-thione?
The InChIKey is DUNVZXBCSSYLSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13BrN2O2S2/c13-8-3-4-11-10(6-8)14-12(18)15(11)9-2-1-5-19(16,17)7-9/h3-4,6,9H,1-2,5,7H2,(H,14,18).
What are the key properties of 6-bromo-3-(1,1-dioxothian-3-yl)-1H-benzimidazole-2-thione?
6-bromo-3-(1,1-dioxothian-3-yl)-1H-benzimidazole-2-thione has a molecular weight of 361.29 g/mol, XLogP of 3.21, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-3-(1,1-dioxothian-3-yl)-1H-benzimidazole-2-thione is sourced from PubChem (CID 63923374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).