About N-(1,1-dioxothian-3-yl)-1,3-benzoxazol-2-amine
N-(1,1-dioxothian-3-yl)-1,3-benzoxazol-2-amine (PubChem CID 63923752) has the molecular formula C12H14N2O3S
and a molecular weight of 266.32 g/mol. Its IUPAC name is N-(1,1-dioxothian-3-yl)-1,3-benzoxazol-2-amine.
Molecular Properties
| Compound Name | N-(1,1-dioxothian-3-yl)-1,3-benzoxazol-2-amine |
| PubChem CID | 63923752 |
| Molecular Formula | C12H14N2O3S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | N-(1,1-dioxothian-3-yl)-1,3-benzoxazol-2-amine |
| SMILES | O=S1(=O)CCCC(Nc2nc3ccccc3o2)C1 |
| InChI | InChI=1S/C12H14N2O3S/c15-18(16)7-3-4-9(8-18)13-12-14-10-5-1-2-6-11(10)17-12/h1-2,5-6,9H,3-4,7-8H2,(H,13,14) |
| InChIKey | YFEUDEPFQBYPMI-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(1,1-dioxothian-3-yl)-1,3-benzoxazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,1-dioxothian-3-yl)-1,3-benzoxazol-2-amine?
The IUPAC name of N-(1,1-dioxothian-3-yl)-1,3-benzoxazol-2-amine (CID 63923752) is N-(1,1-dioxothian-3-yl)-1,3-benzoxazol-2-amine.
What is the SMILES notation for N-(1,1-dioxothian-3-yl)-1,3-benzoxazol-2-amine?
The canonical SMILES for N-(1,1-dioxothian-3-yl)-1,3-benzoxazol-2-amine is O=S1(=O)CCCC(Nc2nc3ccccc3o2)C1.
What is the InChIKey of N-(1,1-dioxothian-3-yl)-1,3-benzoxazol-2-amine?
The InChIKey is YFEUDEPFQBYPMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O3S/c15-18(16)7-3-4-9(8-18)13-12-14-10-5-1-2-6-11(10)17-12/h1-2,5-6,9H,3-4,7-8H2,(H,13,14).
What are the key properties of N-(1,1-dioxothian-3-yl)-1,3-benzoxazol-2-amine?
N-(1,1-dioxothian-3-yl)-1,3-benzoxazol-2-amine has a molecular weight of 266.32 g/mol, XLogP of 1.82, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,1-dioxothian-3-yl)-1,3-benzoxazol-2-amine is sourced from PubChem (CID 63923752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).