C11H22N2O2S — CID 63923859
[1-(1,1-dioxothian-3-yl)piperidin-2-yl]methanamine (PubChem CID 63923859) has the molecular formula C11H22N2O2S and a molecular weight of 246.38 g/mol. Its IUPAC name is [1-(1,1-dioxothian-3-yl)piperidin-2-yl]methanamine.
| Compound Name | [1-(1,1-dioxothian-3-yl)piperidin-2-yl]methanamine |
|---|---|
| PubChem CID | 63923859 |
| Molecular Formula | C11H22N2O2S |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | [1-(1,1-dioxothian-3-yl)piperidin-2-yl]methanamine |
| SMILES | NCC1CCCCN1C1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H22N2O2S/c12-8-10-4-1-2-6-13(10)11-5-3-7-16(14,15)9-11/h10-11H,1-9,12H2 |
| InChIKey | UYGYBATXFNQJMD-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |