About 2,2-difluoro-2-(3-hydroxy-1,1-dioxothian-3-yl)acetic acid
2,2-difluoro-2-(3-hydroxy-1,1-dioxothian-3-yl)acetic acid (PubChem CID 63923868) has the molecular formula C7H10F2O5S
and a molecular weight of 244.21 g/mol. Its IUPAC name is 2,2-difluoro-2-(3-hydroxy-1,1-dioxothian-3-yl)acetic acid.
Molecular Properties
| Compound Name | 2,2-difluoro-2-(3-hydroxy-1,1-dioxothian-3-yl)acetic acid |
| PubChem CID | 63923868 |
| Molecular Formula | C7H10F2O5S |
| Molecular Weight | 244.21 g/mol |
| Exact Mass | 244.02 |
| IUPAC Name | 2,2-difluoro-2-(3-hydroxy-1,1-dioxothian-3-yl)acetic acid |
| SMILES | O=C(O)C(F)(F)C1(O)CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C7H10F2O5S/c8-7(9,5(10)11)6(12)2-1-3-15(13,14)4-6/h12H,1-4H2,(H,10,11) |
| InChIKey | VHUALGOSXHSJRA-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.21 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,2-difluoro-2-(3-hydroxy-1,1-dioxothian-3-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoro-2-(3-hydroxy-1,1-dioxothian-3-yl)acetic acid?
The IUPAC name of 2,2-difluoro-2-(3-hydroxy-1,1-dioxothian-3-yl)acetic acid (CID 63923868) is 2,2-difluoro-2-(3-hydroxy-1,1-dioxothian-3-yl)acetic acid.
What is the SMILES notation for 2,2-difluoro-2-(3-hydroxy-1,1-dioxothian-3-yl)acetic acid?
The canonical SMILES for 2,2-difluoro-2-(3-hydroxy-1,1-dioxothian-3-yl)acetic acid is O=C(O)C(F)(F)C1(O)CCCS(=O)(=O)C1.
What is the InChIKey of 2,2-difluoro-2-(3-hydroxy-1,1-dioxothian-3-yl)acetic acid?
The InChIKey is VHUALGOSXHSJRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10F2O5S/c8-7(9,5(10)11)6(12)2-1-3-15(13,14)4-6/h12H,1-4H2,(H,10,11).
What are the key properties of 2,2-difluoro-2-(3-hydroxy-1,1-dioxothian-3-yl)acetic acid?
2,2-difluoro-2-(3-hydroxy-1,1-dioxothian-3-yl)acetic acid has a molecular weight of 244.21 g/mol, XLogP of -0.35, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-2-(3-hydroxy-1,1-dioxothian-3-yl)acetic acid is sourced from PubChem (CID 63923868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).