2,2-difluoro-2-(3-hydroxy-1,1-dioxothian-3-yl)acetic acid

C7H10F2O5S — CID 63923868

IUPAC2,2-difluoro-2-(3-hydroxy-1,1-dioxothian-3-yl)acetic acid
SMILESO=C(O)C(F)(F)C1(O)CCCS(=O)(=O)C1
InChIInChI=1S/C7H10F2O5S/c8-7(9,5(10)11)6(12)2-1-3-15(13,14)4-6/h12H,1-4H2,(H,10,11)
InChIKeyVHUALGOSXHSJRA-UHFFFAOYSA-N
MW244.21 g/mol
LogP-0.35
Rot. Bonds2

About 2,2-difluoro-2-(3-hydroxy-1,1-dioxothian-3-yl)acetic acid

2,2-difluoro-2-(3-hydroxy-1,1-dioxothian-3-yl)acetic acid (PubChem CID 63923868) has the molecular formula C7H10F2O5S and a molecular weight of 244.21 g/mol. Its IUPAC name is 2,2-difluoro-2-(3-hydroxy-1,1-dioxothian-3-yl)acetic acid.

Molecular Properties

Compound Name2,2-difluoro-2-(3-hydroxy-1,1-dioxothian-3-yl)acetic acid
PubChem CID63923868
Molecular FormulaC7H10F2O5S
Molecular Weight244.21 g/mol
Exact Mass244.02
IUPAC Name2,2-difluoro-2-(3-hydroxy-1,1-dioxothian-3-yl)acetic acid
SMILESO=C(O)C(F)(F)C1(O)CCCS(=O)(=O)C1
InChIInChI=1S/C7H10F2O5S/c8-7(9,5(10)11)6(12)2-1-3-15(13,14)4-6/h12H,1-4H2,(H,10,11)
InChIKeyVHUALGOSXHSJRA-UHFFFAOYSA-N
XLogP-0.35
TPSA91.67 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.21
LogP ≤ 5-0.35
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2,2-difluoro-2-(3-hydroxy-1,1-dioxothian-3-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2-difluoro-2-(3-hydroxy-1,1-dioxothian-3-yl)acetic acid?
The IUPAC name of 2,2-difluoro-2-(3-hydroxy-1,1-dioxothian-3-yl)acetic acid (CID 63923868) is 2,2-difluoro-2-(3-hydroxy-1,1-dioxothian-3-yl)acetic acid.
What is the SMILES notation for 2,2-difluoro-2-(3-hydroxy-1,1-dioxothian-3-yl)acetic acid?
The canonical SMILES for 2,2-difluoro-2-(3-hydroxy-1,1-dioxothian-3-yl)acetic acid is O=C(O)C(F)(F)C1(O)CCCS(=O)(=O)C1.
What is the InChIKey of 2,2-difluoro-2-(3-hydroxy-1,1-dioxothian-3-yl)acetic acid?
The InChIKey is VHUALGOSXHSJRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10F2O5S/c8-7(9,5(10)11)6(12)2-1-3-15(13,14)4-6/h12H,1-4H2,(H,10,11).
What are the key properties of 2,2-difluoro-2-(3-hydroxy-1,1-dioxothian-3-yl)acetic acid?
2,2-difluoro-2-(3-hydroxy-1,1-dioxothian-3-yl)acetic acid has a molecular weight of 244.21 g/mol, XLogP of -0.35, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-2-(3-hydroxy-1,1-dioxothian-3-yl)acetic acid is sourced from PubChem (CID 63923868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).