About N-(1,1-dioxothian-3-yl)-1,4-dioxaspiro[4.5]decan-8-amine
N-(1,1-dioxothian-3-yl)-1,4-dioxaspiro[4.5]decan-8-amine (PubChem CID 63923910) has the molecular formula C13H23NO4S
and a molecular weight of 289.40 g/mol. Its IUPAC name is N-(1,1-dioxothian-3-yl)-1,4-dioxaspiro[4.5]decan-8-amine.
Molecular Properties
| Compound Name | N-(1,1-dioxothian-3-yl)-1,4-dioxaspiro[4.5]decan-8-amine |
| PubChem CID | 63923910 |
| Molecular Formula | C13H23NO4S |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | N-(1,1-dioxothian-3-yl)-1,4-dioxaspiro[4.5]decan-8-amine |
| SMILES | O=S1(=O)CCCC(NC2CCC3(CC2)OCCO3)C1 |
| InChI | InChI=1S/C13H23NO4S/c15-19(16)9-1-2-12(10-19)14-11-3-5-13(6-4-11)17-7-8-18-13/h11-12,14H,1-10H2 |
| InChIKey | VGMKCGBLSHLZGG-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(1,1-dioxothian-3-yl)-1,4-dioxaspiro[4.5]decan-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,1-dioxothian-3-yl)-1,4-dioxaspiro[4.5]decan-8-amine?
The IUPAC name of N-(1,1-dioxothian-3-yl)-1,4-dioxaspiro[4.5]decan-8-amine (CID 63923910) is N-(1,1-dioxothian-3-yl)-1,4-dioxaspiro[4.5]decan-8-amine.
What is the SMILES notation for N-(1,1-dioxothian-3-yl)-1,4-dioxaspiro[4.5]decan-8-amine?
The canonical SMILES for N-(1,1-dioxothian-3-yl)-1,4-dioxaspiro[4.5]decan-8-amine is O=S1(=O)CCCC(NC2CCC3(CC2)OCCO3)C1.
What is the InChIKey of N-(1,1-dioxothian-3-yl)-1,4-dioxaspiro[4.5]decan-8-amine?
The InChIKey is VGMKCGBLSHLZGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO4S/c15-19(16)9-1-2-12(10-19)14-11-3-5-13(6-4-11)17-7-8-18-13/h11-12,14H,1-10H2.
What are the key properties of N-(1,1-dioxothian-3-yl)-1,4-dioxaspiro[4.5]decan-8-amine?
N-(1,1-dioxothian-3-yl)-1,4-dioxaspiro[4.5]decan-8-amine has a molecular weight of 289.40 g/mol, XLogP of 0.84, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,1-dioxothian-3-yl)-1,4-dioxaspiro[4.5]decan-8-amine is sourced from PubChem (CID 63923910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).