C9H15N5O3S — CID 63924467
2-(3-amino-1,2,4-triazol-1-yl)-N-(1,1-dioxothian-3-yl)acetamide (PubChem CID 63924467) has the molecular formula C9H15N5O3S and a molecular weight of 273.32 g/mol. Its IUPAC name is 2-(3-amino-1,2,4-triazol-1-yl)-N-(1,1-dioxothian-3-yl)acetamide.
| Compound Name | 2-(3-amino-1,2,4-triazol-1-yl)-N-(1,1-dioxothian-3-yl)acetamide |
|---|---|
| PubChem CID | 63924467 |
| Molecular Formula | C9H15N5O3S |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 2-(3-amino-1,2,4-triazol-1-yl)-N-(1,1-dioxothian-3-yl)acetamide |
| SMILES | Nc1ncn(CC(=O)NC2CCCS(=O)(=O)C2)n1 |
| InChI | InChI=1S/C9H15N5O3S/c10-9-11-6-14(13-9)4-8(15)12-7-2-1-3-18(16,17)5-7/h6-7H,1-5H2,(H2,10,13)(H,12,15) |
| InChIKey | JWRQUGADMQUIPW-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |