C9H17NO3 — CID 63925332
2-(5-methylhexan-2-ylamino)-2-oxoacetic acid (PubChem CID 63925332) has the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. Its IUPAC name is 2-(5-methylhexan-2-ylamino)-2-oxoacetic acid.
| Compound Name | 2-(5-methylhexan-2-ylamino)-2-oxoacetic acid |
|---|---|
| PubChem CID | 63925332 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | 2-(5-methylhexan-2-ylamino)-2-oxoacetic acid |
| SMILES | CC(C)CCC(C)NC(=O)C(=O)O |
| InChI | InChI=1S/C9H17NO3/c1-6(2)4-5-7(3)10-8(11)9(12)13/h6-7H,4-5H2,1-3H3,(H,10,11)(H,12,13) |
| InChIKey | WMYBTEHWRNISTK-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|