C9H16O4 — CID 639256
4,4-dimethyl-5-[(3R)-1,2,4-trioxolan-3-yl]pentan-2-one (PubChem CID 639256) has the molecular formula C9H16O4 and a molecular weight of 188.22 g/mol. Its IUPAC name is 4,4-dimethyl-5-[(3R)-1,2,4-trioxolan-3-yl]pentan-2-one.
| Compound Name | 4,4-dimethyl-5-[(3R)-1,2,4-trioxolan-3-yl]pentan-2-one |
|---|---|
| PubChem CID | 639256 |
| Molecular Formula | C9H16O4 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | 4,4-dimethyl-5-[(3R)-1,2,4-trioxolan-3-yl]pentan-2-one |
| SMILES | CC(=O)CC(C)(C)C[C@@H]1OCOO1 |
| InChI | InChI=1S/C9H16O4/c1-7(10)4-9(2,3)5-8-11-6-12-13-8/h8H,4-6H2,1-3H3/t8-/m1/s1 |
| InChIKey | FOLIAKDPGORQFO-MRVPVSSYSA-N |
| XLogP | 1.64 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|