About dichlorocobalt;2-diphenylphosphaniumylethyl(diphenyl)phosphanium
dichlorocobalt;2-diphenylphosphaniumylethyl(diphenyl)phosphanium (PubChem CID 6392659) has the molecular formula C26H26Cl2CoP2+2
and a molecular weight of 530.28 g/mol. Its IUPAC name is dichlorocobalt;2-diphenylphosphaniumylethyl(diphenyl)phosphanium.
Molecular Properties
| Compound Name | dichlorocobalt;2-diphenylphosphaniumylethyl(diphenyl)phosphanium |
| PubChem CID | 6392659 |
| Molecular Formula | C26H26Cl2CoP2+2 |
| Molecular Weight | 530.28 g/mol |
| Exact Mass | 529.02 |
| IUPAC Name | dichlorocobalt;2-diphenylphosphaniumylethyl(diphenyl)phosphanium |
| SMILES | Cl[Co]Cl.c1ccc([PH+](CC[PH+](c2ccccc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H24P2.2ClH.Co/c1-5-13-23(14-6-1)27(24-15-7-2-8-16-24)21-22-28(25-17-9-3-10-18-25)26-19-11-4-12-20-26;;;/h1-20H,21-22H2;2*1H;/q;;;+2 |
| InChIKey | SYTWXWRJCLAZFP-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 530.28 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dichlorocobalt;2-diphenylphosphaniumylethyl(diphenyl)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorocobalt;2-diphenylphosphaniumylethyl(diphenyl)phosphanium?
The IUPAC name of dichlorocobalt;2-diphenylphosphaniumylethyl(diphenyl)phosphanium (CID 6392659) is dichlorocobalt;2-diphenylphosphaniumylethyl(diphenyl)phosphanium.
What is the SMILES notation for dichlorocobalt;2-diphenylphosphaniumylethyl(diphenyl)phosphanium?
The canonical SMILES for dichlorocobalt;2-diphenylphosphaniumylethyl(diphenyl)phosphanium is Cl[Co]Cl.c1ccc([PH+](CC[PH+](c2ccccc2)c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of dichlorocobalt;2-diphenylphosphaniumylethyl(diphenyl)phosphanium?
The InChIKey is SYTWXWRJCLAZFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H24P2.2ClH.Co/c1-5-13-23(14-6-1)27(24-15-7-2-8-16-24)21-22-28(25-17-9-3-10-18-25)26-19-11-4-12-20-26;;;/h1-20H,21-22H2;2*1H;/q;;;+2.
What are the key properties of dichlorocobalt;2-diphenylphosphaniumylethyl(diphenyl)phosphanium?
dichlorocobalt;2-diphenylphosphaniumylethyl(diphenyl)phosphanium has a molecular weight of 530.28 g/mol, XLogP of 6.09, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorocobalt;2-diphenylphosphaniumylethyl(diphenyl)phosphanium is sourced from PubChem (CID 6392659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).