About [(Z)-(3-methyl-2,4-dioxocyclopentylidene)amino]urea
[(Z)-(3-methyl-2,4-dioxocyclopentylidene)amino]urea (PubChem CID 6392667) has the molecular formula C7H9N3O3
and a molecular weight of 183.17 g/mol. Its IUPAC name is [(Z)-(3-methyl-2,4-dioxocyclopentylidene)amino]urea.
Molecular Properties
| Compound Name | [(Z)-(3-methyl-2,4-dioxocyclopentylidene)amino]urea |
| PubChem CID | 6392667 |
| Molecular Formula | C7H9N3O3 |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | [(Z)-(3-methyl-2,4-dioxocyclopentylidene)amino]urea |
| SMILES | CC1C(=O)C/C(=N/NC(N)=O)C1=O |
| InChI | InChI=1S/C7H9N3O3/c1-3-5(11)2-4(6(3)12)9-10-7(8)13/h3H,2H2,1H3,(H3,8,10,13)/b9-4- |
| InChIKey | HQZUDTSXTQELHB-WTKPLQERSA-N |
| XLogP | -0.81 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-(3-methyl-2,4-dioxocyclopentylidene)amino]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-(3-methyl-2,4-dioxocyclopentylidene)amino]urea?
The IUPAC name of [(Z)-(3-methyl-2,4-dioxocyclopentylidene)amino]urea (CID 6392667) is [(Z)-(3-methyl-2,4-dioxocyclopentylidene)amino]urea.
What is the SMILES notation for [(Z)-(3-methyl-2,4-dioxocyclopentylidene)amino]urea?
The canonical SMILES for [(Z)-(3-methyl-2,4-dioxocyclopentylidene)amino]urea is CC1C(=O)C/C(=N/NC(N)=O)C1=O.
What is the InChIKey of [(Z)-(3-methyl-2,4-dioxocyclopentylidene)amino]urea?
The InChIKey is HQZUDTSXTQELHB-WTKPLQERSA-N. The full InChI is InChI=1S/C7H9N3O3/c1-3-5(11)2-4(6(3)12)9-10-7(8)13/h3H,2H2,1H3,(H3,8,10,13)/b9-4-.
What are the key properties of [(Z)-(3-methyl-2,4-dioxocyclopentylidene)amino]urea?
[(Z)-(3-methyl-2,4-dioxocyclopentylidene)amino]urea has a molecular weight of 183.17 g/mol, XLogP of -0.81, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-(3-methyl-2,4-dioxocyclopentylidene)amino]urea is sourced from PubChem (CID 6392667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).