C14H14BrNO — CID 63926863
(2-bromophenyl)-(3,4,5-trimethyl-1H-pyrrol-2-yl)methanone (PubChem CID 63926863) has the molecular formula C14H14BrNO and a molecular weight of 292.18 g/mol. Its IUPAC name is (2-bromophenyl)-(3,4,5-trimethyl-1H-pyrrol-2-yl)methanone.
| Compound Name | (2-bromophenyl)-(3,4,5-trimethyl-1H-pyrrol-2-yl)methanone |
|---|---|
| PubChem CID | 63926863 |
| Molecular Formula | C14H14BrNO |
| Molecular Weight | 292.18 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | (2-bromophenyl)-(3,4,5-trimethyl-1H-pyrrol-2-yl)methanone |
| SMILES | Cc1[nH]c(C(=O)c2ccccc2Br)c(C)c1C |
| InChI | InChI=1S/C14H14BrNO/c1-8-9(2)13(16-10(8)3)14(17)11-6-4-5-7-12(11)15/h4-7,16H,1-3H3 |
| InChIKey | ODZNOTRWLCLXAO-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.18 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |