About furan-3-yl-(3,4,5-trimethyl-1H-pyrrol-2-yl)methanol
furan-3-yl-(3,4,5-trimethyl-1H-pyrrol-2-yl)methanol (PubChem CID 63927081) has the molecular formula C12H15NO2
and a molecular weight of 205.26 g/mol. Its IUPAC name is furan-3-yl-(3,4,5-trimethyl-1H-pyrrol-2-yl)methanol.
Molecular Properties
| Compound Name | furan-3-yl-(3,4,5-trimethyl-1H-pyrrol-2-yl)methanol |
| PubChem CID | 63927081 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | furan-3-yl-(3,4,5-trimethyl-1H-pyrrol-2-yl)methanol |
| SMILES | Cc1[nH]c(C(O)c2ccoc2)c(C)c1C |
| InChI | InChI=1S/C12H15NO2/c1-7-8(2)11(13-9(7)3)12(14)10-4-5-15-6-10/h4-6,12-14H,1-3H3 |
| InChIKey | NUJPNYQFYRHKBK-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 49.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze furan-3-yl-(3,4,5-trimethyl-1H-pyrrol-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan-3-yl-(3,4,5-trimethyl-1H-pyrrol-2-yl)methanol?
The IUPAC name of furan-3-yl-(3,4,5-trimethyl-1H-pyrrol-2-yl)methanol (CID 63927081) is furan-3-yl-(3,4,5-trimethyl-1H-pyrrol-2-yl)methanol.
What is the SMILES notation for furan-3-yl-(3,4,5-trimethyl-1H-pyrrol-2-yl)methanol?
The canonical SMILES for furan-3-yl-(3,4,5-trimethyl-1H-pyrrol-2-yl)methanol is Cc1[nH]c(C(O)c2ccoc2)c(C)c1C.
What is the InChIKey of furan-3-yl-(3,4,5-trimethyl-1H-pyrrol-2-yl)methanol?
The InChIKey is NUJPNYQFYRHKBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO2/c1-7-8(2)11(13-9(7)3)12(14)10-4-5-15-6-10/h4-6,12-14H,1-3H3.
What are the key properties of furan-3-yl-(3,4,5-trimethyl-1H-pyrrol-2-yl)methanol?
furan-3-yl-(3,4,5-trimethyl-1H-pyrrol-2-yl)methanol has a molecular weight of 205.26 g/mol, XLogP of 2.61, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for furan-3-yl-(3,4,5-trimethyl-1H-pyrrol-2-yl)methanol is sourced from PubChem (CID 63927081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).