About N-(3,4-dihydrochromeno[3,4-d]imidazol-2-ylmethyl)ethanamine
N-(3,4-dihydrochromeno[3,4-d]imidazol-2-ylmethyl)ethanamine (PubChem CID 63927592) has the molecular formula C13H15N3O
and a molecular weight of 229.28 g/mol. Its IUPAC name is N-(3,4-dihydrochromeno[3,4-d]imidazol-2-ylmethyl)ethanamine.
Molecular Properties
| Compound Name | N-(3,4-dihydrochromeno[3,4-d]imidazol-2-ylmethyl)ethanamine |
| PubChem CID | 63927592 |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | N-(3,4-dihydrochromeno[3,4-d]imidazol-2-ylmethyl)ethanamine |
| SMILES | CCNCc1nc2c([nH]1)COc1ccccc1-2 |
| InChI | InChI=1S/C13H15N3O/c1-2-14-7-12-15-10-8-17-11-6-4-3-5-9(11)13(10)16-12/h3-6,14H,2,7-8H2,1H3,(H,15,16) |
| InChIKey | FEACTDBCRRBZPO-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(3,4-dihydrochromeno[3,4-d]imidazol-2-ylmethyl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4-dihydrochromeno[3,4-d]imidazol-2-ylmethyl)ethanamine?
The IUPAC name of N-(3,4-dihydrochromeno[3,4-d]imidazol-2-ylmethyl)ethanamine (CID 63927592) is N-(3,4-dihydrochromeno[3,4-d]imidazol-2-ylmethyl)ethanamine.
What is the SMILES notation for N-(3,4-dihydrochromeno[3,4-d]imidazol-2-ylmethyl)ethanamine?
The canonical SMILES for N-(3,4-dihydrochromeno[3,4-d]imidazol-2-ylmethyl)ethanamine is CCNCc1nc2c([nH]1)COc1ccccc1-2.
What is the InChIKey of N-(3,4-dihydrochromeno[3,4-d]imidazol-2-ylmethyl)ethanamine?
The InChIKey is FEACTDBCRRBZPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3O/c1-2-14-7-12-15-10-8-17-11-6-4-3-5-9(11)13(10)16-12/h3-6,14H,2,7-8H2,1H3,(H,15,16).
What are the key properties of N-(3,4-dihydrochromeno[3,4-d]imidazol-2-ylmethyl)ethanamine?
N-(3,4-dihydrochromeno[3,4-d]imidazol-2-ylmethyl)ethanamine has a molecular weight of 229.28 g/mol, XLogP of 2.08, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4-dihydrochromeno[3,4-d]imidazol-2-ylmethyl)ethanamine is sourced from PubChem (CID 63927592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).