C12H25NO3 — CID 63928354
1-[1-cyclopropylethyl(2-methoxyethyl)amino]-3-methoxypropan-2-ol (PubChem CID 63928354) has the molecular formula C12H25NO3 and a molecular weight of 231.34 g/mol. Its IUPAC name is 1-[1-cyclopropylethyl(2-methoxyethyl)amino]-3-methoxypropan-2-ol.
| Compound Name | 1-[1-cyclopropylethyl(2-methoxyethyl)amino]-3-methoxypropan-2-ol |
|---|---|
| PubChem CID | 63928354 |
| Molecular Formula | C12H25NO3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.18 |
| IUPAC Name | 1-[1-cyclopropylethyl(2-methoxyethyl)amino]-3-methoxypropan-2-ol |
| SMILES | COCCN(CC(O)COC)C(C)C1CC1 |
| InChI | InChI=1S/C12H25NO3/c1-10(11-4-5-11)13(6-7-15-2)8-12(14)9-16-3/h10-12,14H,4-9H2,1-3H3 |
| InChIKey | RNKYRLOTTNQSDY-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |