C14H14N2O2 — CID 63929987
3-methyl-1-(1,2,3,4-tetrahydroquinolin-7-yl)pyrrole-2,5-dione (PubChem CID 63929987) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is 3-methyl-1-(1,2,3,4-tetrahydroquinolin-7-yl)pyrrole-2,5-dione.
| Compound Name | 3-methyl-1-(1,2,3,4-tetrahydroquinolin-7-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 63929987 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 3-methyl-1-(1,2,3,4-tetrahydroquinolin-7-yl)pyrrole-2,5-dione |
| SMILES | CC1=CC(=O)N(c2ccc3c(c2)NCCC3)C1=O |
| InChI | InChI=1S/C14H14N2O2/c1-9-7-13(17)16(14(9)18)11-5-4-10-3-2-6-15-12(10)8-11/h4-5,7-8,15H,2-3,6H2,1H3 |
| InChIKey | JQAWPAZWLWRQLY-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|