About 1-[(3,5-dimethylphenyl)methylamino]-2-methylpropan-2-ol
1-[(3,5-dimethylphenyl)methylamino]-2-methylpropan-2-ol (PubChem CID 63932078) has the molecular formula C13H21NO
and a molecular weight of 207.32 g/mol. Its IUPAC name is 1-[(3,5-dimethylphenyl)methylamino]-2-methylpropan-2-ol.
Molecular Properties
| Compound Name | 1-[(3,5-dimethylphenyl)methylamino]-2-methylpropan-2-ol |
| PubChem CID | 63932078 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | 1-[(3,5-dimethylphenyl)methylamino]-2-methylpropan-2-ol |
| SMILES | Cc1cc(C)cc(CNCC(C)(C)O)c1 |
| InChI | InChI=1S/C13H21NO/c1-10-5-11(2)7-12(6-10)8-14-9-13(3,4)15/h5-7,14-15H,8-9H2,1-4H3 |
| InChIKey | MAWMCBNBRZWVTE-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(3,5-dimethylphenyl)methylamino]-2-methylpropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,5-dimethylphenyl)methylamino]-2-methylpropan-2-ol?
The IUPAC name of 1-[(3,5-dimethylphenyl)methylamino]-2-methylpropan-2-ol (CID 63932078) is 1-[(3,5-dimethylphenyl)methylamino]-2-methylpropan-2-ol.
What is the SMILES notation for 1-[(3,5-dimethylphenyl)methylamino]-2-methylpropan-2-ol?
The canonical SMILES for 1-[(3,5-dimethylphenyl)methylamino]-2-methylpropan-2-ol is Cc1cc(C)cc(CNCC(C)(C)O)c1.
What is the InChIKey of 1-[(3,5-dimethylphenyl)methylamino]-2-methylpropan-2-ol?
The InChIKey is MAWMCBNBRZWVTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NO/c1-10-5-11(2)7-12(6-10)8-14-9-13(3,4)15/h5-7,14-15H,8-9H2,1-4H3.
What are the key properties of 1-[(3,5-dimethylphenyl)methylamino]-2-methylpropan-2-ol?
1-[(3,5-dimethylphenyl)methylamino]-2-methylpropan-2-ol has a molecular weight of 207.32 g/mol, XLogP of 2.16, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,5-dimethylphenyl)methylamino]-2-methylpropan-2-ol is sourced from PubChem (CID 63932078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).