C10H21NO4 — CID 63933197
3-[(3-ethoxy-2-hydroxypropyl)-methylamino]-2-methylpropanoic acid (PubChem CID 63933197) has the molecular formula C10H21NO4 and a molecular weight of 219.28 g/mol. Its IUPAC name is 3-[(3-ethoxy-2-hydroxypropyl)-methylamino]-2-methylpropanoic acid.
| Compound Name | 3-[(3-ethoxy-2-hydroxypropyl)-methylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 63933197 |
| Molecular Formula | C10H21NO4 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | 3-[(3-ethoxy-2-hydroxypropyl)-methylamino]-2-methylpropanoic acid |
| SMILES | CCOCC(O)CN(C)CC(C)C(=O)O |
| InChI | InChI=1S/C10H21NO4/c1-4-15-7-9(12)6-11(3)5-8(2)10(13)14/h8-9,12H,4-7H2,1-3H3,(H,13,14) |
| InChIKey | BPYJTGRPKMCTFW-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |