About 1-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-3-ethoxypropan-2-ol
1-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-3-ethoxypropan-2-ol (PubChem CID 63934691) has the molecular formula C9H17N3O2S2
and a molecular weight of 263.39 g/mol. Its IUPAC name is 1-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-3-ethoxypropan-2-ol.
Molecular Properties
| Compound Name | 1-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-3-ethoxypropan-2-ol |
| PubChem CID | 63934691 |
| Molecular Formula | C9H17N3O2S2 |
| Molecular Weight | 263.39 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 1-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-3-ethoxypropan-2-ol |
| SMILES | CCOCC(O)CSc1nnc(N(C)C)s1 |
| InChI | InChI=1S/C9H17N3O2S2/c1-4-14-5-7(13)6-15-9-11-10-8(16-9)12(2)3/h7,13H,4-6H2,1-3H3 |
| InChIKey | OWGVNSOMYDSAFX-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 58.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.39 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-3-ethoxypropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-3-ethoxypropan-2-ol?
The IUPAC name of 1-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-3-ethoxypropan-2-ol (CID 63934691) is 1-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-3-ethoxypropan-2-ol.
What is the SMILES notation for 1-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-3-ethoxypropan-2-ol?
The canonical SMILES for 1-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-3-ethoxypropan-2-ol is CCOCC(O)CSc1nnc(N(C)C)s1.
What is the InChIKey of 1-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-3-ethoxypropan-2-ol?
The InChIKey is OWGVNSOMYDSAFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3O2S2/c1-4-14-5-7(13)6-15-9-11-10-8(16-9)12(2)3/h7,13H,4-6H2,1-3H3.
What are the key properties of 1-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-3-ethoxypropan-2-ol?
1-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-3-ethoxypropan-2-ol has a molecular weight of 263.39 g/mol, XLogP of 1.09, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-3-ethoxypropan-2-ol is sourced from PubChem (CID 63934691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).