1-(oxan-4-yl)pyrrolidine-3-carboxylic acid

C10H17NO3 — CID 63935639

IUPAC1-(oxan-4-yl)pyrrolidine-3-carboxylic acid
SMILESO=C(O)C1CCN(C2CCOCC2)C1
InChIInChI=1S/C10H17NO3/c12-10(13)8-1-4-11(7-8)9-2-5-14-6-3-9/h8-9H,1-7H2,(H,12,13)
InChIKeyROPWGCICXUMNPU-UHFFFAOYSA-N
MW199.25 g/mol
LogP0.57
Rot. Bonds2

About 1-(oxan-4-yl)pyrrolidine-3-carboxylic acid

1-(oxan-4-yl)pyrrolidine-3-carboxylic acid (PubChem CID 63935639) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is 1-(oxan-4-yl)pyrrolidine-3-carboxylic acid.

Molecular Properties

Compound Name1-(oxan-4-yl)pyrrolidine-3-carboxylic acid
PubChem CID63935639
Molecular FormulaC10H17NO3
Molecular Weight199.25 g/mol
Exact Mass199.12
IUPAC Name1-(oxan-4-yl)pyrrolidine-3-carboxylic acid
SMILESO=C(O)C1CCN(C2CCOCC2)C1
InChIInChI=1S/C10H17NO3/c12-10(13)8-1-4-11(7-8)9-2-5-14-6-3-9/h8-9H,1-7H2,(H,12,13)
InChIKeyROPWGCICXUMNPU-UHFFFAOYSA-N
XLogP0.57
TPSA49.77 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500199.25
LogP ≤ 50.57
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 1-(oxan-4-yl)pyrrolidine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(oxan-4-yl)pyrrolidine-3-carboxylic acid?
The IUPAC name of 1-(oxan-4-yl)pyrrolidine-3-carboxylic acid (CID 63935639) is 1-(oxan-4-yl)pyrrolidine-3-carboxylic acid.
What is the SMILES notation for 1-(oxan-4-yl)pyrrolidine-3-carboxylic acid?
The canonical SMILES for 1-(oxan-4-yl)pyrrolidine-3-carboxylic acid is O=C(O)C1CCN(C2CCOCC2)C1.
What is the InChIKey of 1-(oxan-4-yl)pyrrolidine-3-carboxylic acid?
The InChIKey is ROPWGCICXUMNPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO3/c12-10(13)8-1-4-11(7-8)9-2-5-14-6-3-9/h8-9H,1-7H2,(H,12,13).
What are the key properties of 1-(oxan-4-yl)pyrrolidine-3-carboxylic acid?
1-(oxan-4-yl)pyrrolidine-3-carboxylic acid has a molecular weight of 199.25 g/mol, XLogP of 0.57, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(oxan-4-yl)pyrrolidine-3-carboxylic acid is sourced from PubChem (CID 63935639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).