C15H24N2O — CID 63936019
N'-(2-methylphenyl)-N'-(oxan-4-yl)propane-1,3-diamine (PubChem CID 63936019) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is N'-(2-methylphenyl)-N'-(oxan-4-yl)propane-1,3-diamine.
| Compound Name | N'-(2-methylphenyl)-N'-(oxan-4-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 63936019 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | N'-(2-methylphenyl)-N'-(oxan-4-yl)propane-1,3-diamine |
| SMILES | Cc1ccccc1N(CCCN)C1CCOCC1 |
| InChI | InChI=1S/C15H24N2O/c1-13-5-2-3-6-15(13)17(10-4-9-16)14-7-11-18-12-8-14/h2-3,5-6,14H,4,7-12,16H2,1H3 |
| InChIKey | XEXAQKTXCOBONW-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |