About bis(2-(dimethylamino)ethyl-diphenylphosphanium);palladium(2+)
bis(2-(dimethylamino)ethyl-diphenylphosphanium);palladium(2+) (PubChem CID 6393632) has the molecular formula C32H42N2P2Pd+4
and a molecular weight of 623.07 g/mol. Its IUPAC name is bis(2-(dimethylamino)ethyl-diphenylphosphanium);palladium(2+).
Molecular Properties
| Compound Name | bis(2-(dimethylamino)ethyl-diphenylphosphanium);palladium(2+) |
| PubChem CID | 6393632 |
| Molecular Formula | C32H42N2P2Pd+4 |
| Molecular Weight | 623.07 g/mol |
| Exact Mass | 622.18 |
| IUPAC Name | bis(2-(dimethylamino)ethyl-diphenylphosphanium);palladium(2+) |
| SMILES | CN(C)CC[PH+](c1ccccc1)c1ccccc1.CN(C)CC[PH+](c1ccccc1)c1ccccc1.[Pd+2] |
| InChI | InChI=1S/2C16H20NP.Pd/c2*1-17(2)13-14-18(15-9-5-3-6-10-15)16-11-7-4-8-12-16;/h2*3-12H,13-14H2,1-2H3;/q;;+2/p+2 |
| InChIKey | WAIILCBJMULTIU-UHFFFAOYSA-P |
| XLogP | 4.82 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 623.07 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(2-(dimethylamino)ethyl-diphenylphosphanium);palladium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-(dimethylamino)ethyl-diphenylphosphanium);palladium(2+)?
The IUPAC name of bis(2-(dimethylamino)ethyl-diphenylphosphanium);palladium(2+) (CID 6393632) is bis(2-(dimethylamino)ethyl-diphenylphosphanium);palladium(2+).
What is the SMILES notation for bis(2-(dimethylamino)ethyl-diphenylphosphanium);palladium(2+)?
The canonical SMILES for bis(2-(dimethylamino)ethyl-diphenylphosphanium);palladium(2+) is CN(C)CC[PH+](c1ccccc1)c1ccccc1.CN(C)CC[PH+](c1ccccc1)c1ccccc1.[Pd+2].
What is the InChIKey of bis(2-(dimethylamino)ethyl-diphenylphosphanium);palladium(2+)?
The InChIKey is WAIILCBJMULTIU-UHFFFAOYSA-P. The full InChI is InChI=1S/2C16H20NP.Pd/c2*1-17(2)13-14-18(15-9-5-3-6-10-15)16-11-7-4-8-12-16;/h2*3-12H,13-14H2,1-2H3;/q;;+2/p+2.
What are the key properties of bis(2-(dimethylamino)ethyl-diphenylphosphanium);palladium(2+)?
bis(2-(dimethylamino)ethyl-diphenylphosphanium);palladium(2+) has a molecular weight of 623.07 g/mol, XLogP of 4.82, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-(dimethylamino)ethyl-diphenylphosphanium);palladium(2+) is sourced from PubChem (CID 6393632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).