C16H22O2 — CID 63936880
oxan-4-yl-(1-phenylcyclobutyl)methanol (PubChem CID 63936880) has the molecular formula C16H22O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is oxan-4-yl-(1-phenylcyclobutyl)methanol.
| Compound Name | oxan-4-yl-(1-phenylcyclobutyl)methanol |
|---|---|
| PubChem CID | 63936880 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | oxan-4-yl-(1-phenylcyclobutyl)methanol |
| SMILES | OC(C1CCOCC1)C1(c2ccccc2)CCC1 |
| InChI | InChI=1S/C16H22O2/c17-15(13-7-11-18-12-8-13)16(9-4-10-16)14-5-2-1-3-6-14/h1-3,5-6,13,15,17H,4,7-12H2 |
| InChIKey | ROHJJHXTJBVFPV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |