C12H13N3O2 — CID 63939472
phenyl N-(1H-imidazol-2-ylmethyl)-N-methylcarbamate (PubChem CID 63939472) has the molecular formula C12H13N3O2 and a molecular weight of 231.26 g/mol. Its IUPAC name is phenyl N-(1H-imidazol-2-ylmethyl)-N-methylcarbamate.
| Compound Name | phenyl N-(1H-imidazol-2-ylmethyl)-N-methylcarbamate |
|---|---|
| PubChem CID | 63939472 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | phenyl N-(1H-imidazol-2-ylmethyl)-N-methylcarbamate |
| SMILES | CN(Cc1ncc[nH]1)C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C12H13N3O2/c1-15(9-11-13-7-8-14-11)12(16)17-10-5-3-2-4-6-10/h2-8H,9H2,1H3,(H,13,14) |
| InChIKey | SNVIWTPFXDKDCX-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |