C22H38Br2N4Ni-2 — CID 6393981
dibromonickel;3,11-ditert-butyl-3,11-diaza-17,18-diazanidatricyclo[11.3.1.15,9]octadeca-1(16),14-diene (PubChem CID 6393981) has the molecular formula C22H38Br2N4Ni-2 and a molecular weight of 577.08 g/mol. Its IUPAC name is dibromonickel;3,11-ditert-butyl-3,11-diaza-17,18-diazanidatricyclo[11.3.1.15,9]octadeca-1(16),14-diene.
| Compound Name | dibromonickel;3,11-ditert-butyl-3,11-diaza-17,18-diazanidatricyclo[11.3.1.15,9]octadeca-1(16),14-diene |
|---|---|
| PubChem CID | 6393981 |
| Molecular Formula | C22H38Br2N4Ni-2 |
| Molecular Weight | 577.08 g/mol |
| Exact Mass | 574.08 |
| IUPAC Name | dibromonickel;3,11-ditert-butyl-3,11-diaza-17,18-diazanidatricyclo[11.3.1.15,9]octadeca-1(16),14-diene |
| SMILES | Br[Ni]Br.CC(C)(C)N1CC2=CC=CC(CN(C(C)(C)C)CC3CCCC(C1)[N-]3)[N-]2 |
| InChI | InChI=1S/C22H38N4.2BrH.Ni/c1-21(2,3)25-13-17-9-7-11-19(23-17)15-26(22(4,5)6)16-20-12-8-10-18(14-25)24-20;;;/h7,9,11,17-18,20H,8,10,12-16H2,1-6H3;2*1H;/q-2;;;+2/p-2 |
| InChIKey | WGQVVFPEVYGRRJ-UHFFFAOYSA-L |
| XLogP | 6.38 |
| TPSA | 34.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.08 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |