C12H22N4O3S2 — CID 63939852
2-(ethylsulfonylamino)-N-(1H-imidazol-2-ylmethyl)-N-methyl-4-methylsulfanylbutanamide (PubChem CID 63939852) has the molecular formula C12H22N4O3S2 and a molecular weight of 334.47 g/mol. Its IUPAC name is 2-(ethylsulfonylamino)-N-(1H-imidazol-2-ylmethyl)-N-methyl-4-methylsulfanylbutanamide.
| Compound Name | 2-(ethylsulfonylamino)-N-(1H-imidazol-2-ylmethyl)-N-methyl-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 63939852 |
| Molecular Formula | C12H22N4O3S2 |
| Molecular Weight | 334.47 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 2-(ethylsulfonylamino)-N-(1H-imidazol-2-ylmethyl)-N-methyl-4-methylsulfanylbutanamide |
| SMILES | CCS(=O)(=O)NC(CCSC)C(=O)N(C)Cc1ncc[nH]1 |
| InChI | InChI=1S/C12H22N4O3S2/c1-4-21(18,19)15-10(5-8-20-3)12(17)16(2)9-11-13-6-7-14-11/h6-7,10,15H,4-5,8-9H2,1-3H3,(H,13,14) |
| InChIKey | RZXGUHDHBWVHLI-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.47 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |