C14H14N2 — CID 63940331
4-(1,2,3,6-tetrahydropyridin-4-yl)isoquinoline (PubChem CID 63940331) has the molecular formula C14H14N2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 4-(1,2,3,6-tetrahydropyridin-4-yl)isoquinoline.
| Compound Name | 4-(1,2,3,6-tetrahydropyridin-4-yl)isoquinoline |
|---|---|
| PubChem CID | 63940331 |
| Molecular Formula | C14H14N2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 4-(1,2,3,6-tetrahydropyridin-4-yl)isoquinoline |
| SMILES | C1=C(c2cncc3ccccc23)CCNC1 |
| InChI | InChI=1S/C14H14N2/c1-2-4-13-12(3-1)9-16-10-14(13)11-5-7-15-8-6-11/h1-5,9-10,15H,6-8H2 |
| InChIKey | RTMAOTZUQASTNC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |