C14H20N2O — CID 63940701
2-methyl-4-(1,2,3,4-tetrahydroisoquinolin-4-yl)morpholine (PubChem CID 63940701) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is 2-methyl-4-(1,2,3,4-tetrahydroisoquinolin-4-yl)morpholine.
| Compound Name | 2-methyl-4-(1,2,3,4-tetrahydroisoquinolin-4-yl)morpholine |
|---|---|
| PubChem CID | 63940701 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 2-methyl-4-(1,2,3,4-tetrahydroisoquinolin-4-yl)morpholine |
| SMILES | CC1CN(C2CNCc3ccccc32)CCO1 |
| InChI | InChI=1S/C14H20N2O/c1-11-10-16(6-7-17-11)14-9-15-8-12-4-2-3-5-13(12)14/h2-5,11,14-15H,6-10H2,1H3 |
| InChIKey | UAZOJRLNMKKRKG-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |