C17H11Cl2NO — CID 63940735
2-(3,4-dichlorophenyl)-1-isoquinolin-4-ylethanone (PubChem CID 63940735) has the molecular formula C17H11Cl2NO and a molecular weight of 316.19 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-1-isoquinolin-4-ylethanone.
| Compound Name | 2-(3,4-dichlorophenyl)-1-isoquinolin-4-ylethanone |
|---|---|
| PubChem CID | 63940735 |
| Molecular Formula | C17H11Cl2NO |
| Molecular Weight | 316.19 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-1-isoquinolin-4-ylethanone |
| SMILES | O=C(Cc1ccc(Cl)c(Cl)c1)c1cncc2ccccc12 |
| InChI | InChI=1S/C17H11Cl2NO/c18-15-6-5-11(7-16(15)19)8-17(21)14-10-20-9-12-3-1-2-4-13(12)14/h1-7,9-10H,8H2 |
| InChIKey | JJQQKXMPNNFLKK-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.19 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |