About N-(1-cyano-2-methylpropyl)-3,4,4-trimethylpentanamide
N-(1-cyano-2-methylpropyl)-3,4,4-trimethylpentanamide (PubChem CID 63940823) has the molecular formula C13H24N2O
and a molecular weight of 224.35 g/mol. Its IUPAC name is N-(1-cyano-2-methylpropyl)-3,4,4-trimethylpentanamide.
Molecular Properties
| Compound Name | N-(1-cyano-2-methylpropyl)-3,4,4-trimethylpentanamide |
| PubChem CID | 63940823 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | N-(1-cyano-2-methylpropyl)-3,4,4-trimethylpentanamide |
| SMILES | CC(C)C(C#N)NC(=O)CC(C)C(C)(C)C |
| InChI | InChI=1S/C13H24N2O/c1-9(2)11(8-14)15-12(16)7-10(3)13(4,5)6/h9-11H,7H2,1-6H3,(H,15,16) |
| InChIKey | OIPWYTZJZRJUIN-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(1-cyano-2-methylpropyl)-3,4,4-trimethylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-cyano-2-methylpropyl)-3,4,4-trimethylpentanamide?
The IUPAC name of N-(1-cyano-2-methylpropyl)-3,4,4-trimethylpentanamide (CID 63940823) is N-(1-cyano-2-methylpropyl)-3,4,4-trimethylpentanamide.
What is the SMILES notation for N-(1-cyano-2-methylpropyl)-3,4,4-trimethylpentanamide?
The canonical SMILES for N-(1-cyano-2-methylpropyl)-3,4,4-trimethylpentanamide is CC(C)C(C#N)NC(=O)CC(C)C(C)(C)C.
What is the InChIKey of N-(1-cyano-2-methylpropyl)-3,4,4-trimethylpentanamide?
The InChIKey is OIPWYTZJZRJUIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2O/c1-9(2)11(8-14)15-12(16)7-10(3)13(4,5)6/h9-11H,7H2,1-6H3,(H,15,16).
What are the key properties of N-(1-cyano-2-methylpropyl)-3,4,4-trimethylpentanamide?
N-(1-cyano-2-methylpropyl)-3,4,4-trimethylpentanamide has a molecular weight of 224.35 g/mol, XLogP of 2.72, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-cyano-2-methylpropyl)-3,4,4-trimethylpentanamide is sourced from PubChem (CID 63940823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).