C15H15N3S — CID 63940953
1-isoquinolin-4-yl-2-(4-methyl-1,3-thiazol-2-yl)ethanamine (PubChem CID 63940953) has the molecular formula C15H15N3S and a molecular weight of 269.37 g/mol. Its IUPAC name is 1-isoquinolin-4-yl-2-(4-methyl-1,3-thiazol-2-yl)ethanamine.
| Compound Name | 1-isoquinolin-4-yl-2-(4-methyl-1,3-thiazol-2-yl)ethanamine |
|---|---|
| PubChem CID | 63940953 |
| Molecular Formula | C15H15N3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 1-isoquinolin-4-yl-2-(4-methyl-1,3-thiazol-2-yl)ethanamine |
| SMILES | Cc1csc(CC(N)c2cncc3ccccc23)n1 |
| InChI | InChI=1S/C15H15N3S/c1-10-9-19-15(18-10)6-14(16)13-8-17-7-11-4-2-3-5-12(11)13/h2-5,7-9,14H,6,16H2,1H3 |
| InChIKey | UJQMOMMFCRPZMH-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |