C14H14N2O2 — CID 63941032
N-(1-cyano-2-methylpropyl)-1-benzofuran-2-carboxamide (PubChem CID 63941032) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is N-(1-cyano-2-methylpropyl)-1-benzofuran-2-carboxamide.
| Compound Name | N-(1-cyano-2-methylpropyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 63941032 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | N-(1-cyano-2-methylpropyl)-1-benzofuran-2-carboxamide |
| SMILES | CC(C)C(C#N)NC(=O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C14H14N2O2/c1-9(2)11(8-15)16-14(17)13-7-10-5-3-4-6-12(10)18-13/h3-7,9,11H,1-2H3,(H,16,17) |
| InChIKey | POTRFMQHWKSEGF-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 66.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |