About Tri-t-butylsilane
Tri-t-butylsilane (PubChem CID 6394122) has the molecular formula C12H27Si
and a molecular weight of 199.43 g/mol.
Molecular Properties
| Compound Name | Tri-t-butylsilane |
| PubChem CID | 6394122 |
| Molecular Formula | C12H27Si |
| Molecular Weight | 199.43 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[Si](C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C12H27Si/c1-10(2,3)13(11(4,5)6)12(7,8)9/h1-9H3 |
| InChIKey | STDLEZMOAXZZNH-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.43 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Tri-t-butylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Tri-t-butylsilane?
The IUPAC name of Tri-t-butylsilane (CID 6394122) is not available.
What is the SMILES notation for Tri-t-butylsilane?
The canonical SMILES for Tri-t-butylsilane is CC(C)(C)[Si](C(C)(C)C)C(C)(C)C.
What is the InChIKey of Tri-t-butylsilane?
The InChIKey is STDLEZMOAXZZNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27Si/c1-10(2,3)13(11(4,5)6)12(7,8)9/h1-9H3.
What are the key properties of Tri-t-butylsilane?
Tri-t-butylsilane has a molecular weight of 199.43 g/mol, XLogP of 4.88, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Tri-t-butylsilane is sourced from PubChem (CID 6394122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).