C14H15Br2NO — CID 63941856
1-(3-bromofuran-2-yl)-2-(4-bromophenyl)-N-ethylethanamine (PubChem CID 63941856) has the molecular formula C14H15Br2NO and a molecular weight of 373.09 g/mol. Its IUPAC name is 1-(3-bromofuran-2-yl)-2-(4-bromophenyl)-N-ethylethanamine.
| Compound Name | 1-(3-bromofuran-2-yl)-2-(4-bromophenyl)-N-ethylethanamine |
|---|---|
| PubChem CID | 63941856 |
| Molecular Formula | C14H15Br2NO |
| Molecular Weight | 373.09 g/mol |
| Exact Mass | 370.95 |
| IUPAC Name | 1-(3-bromofuran-2-yl)-2-(4-bromophenyl)-N-ethylethanamine |
| SMILES | CCNC(Cc1ccc(Br)cc1)c1occc1Br |
| InChI | InChI=1S/C14H15Br2NO/c1-2-17-13(14-12(16)7-8-18-14)9-10-3-5-11(15)6-4-10/h3-8,13,17H,2,9H2,1H3 |
| InChIKey | PGBPGCWSFFCNSX-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.09 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |