About 1-(3-bromofuran-2-yl)-N,2-dimethyl-2-phenylpropan-1-amine
1-(3-bromofuran-2-yl)-N,2-dimethyl-2-phenylpropan-1-amine (PubChem CID 63941875) has the molecular formula C15H18BrNO
and a molecular weight of 308.22 g/mol. Its IUPAC name is 1-(3-bromofuran-2-yl)-N,2-dimethyl-2-phenylpropan-1-amine.
Molecular Properties
| Compound Name | 1-(3-bromofuran-2-yl)-N,2-dimethyl-2-phenylpropan-1-amine |
| PubChem CID | 63941875 |
| Molecular Formula | C15H18BrNO |
| Molecular Weight | 308.22 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 1-(3-bromofuran-2-yl)-N,2-dimethyl-2-phenylpropan-1-amine |
| SMILES | CNC(c1occc1Br)C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C15H18BrNO/c1-15(2,11-7-5-4-6-8-11)14(17-3)13-12(16)9-10-18-13/h4-10,14,17H,1-3H3 |
| InChIKey | YNECLCPWIFDGAJ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.22 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(3-bromofuran-2-yl)-N,2-dimethyl-2-phenylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-bromofuran-2-yl)-N,2-dimethyl-2-phenylpropan-1-amine?
The IUPAC name of 1-(3-bromofuran-2-yl)-N,2-dimethyl-2-phenylpropan-1-amine (CID 63941875) is 1-(3-bromofuran-2-yl)-N,2-dimethyl-2-phenylpropan-1-amine.
What is the SMILES notation for 1-(3-bromofuran-2-yl)-N,2-dimethyl-2-phenylpropan-1-amine?
The canonical SMILES for 1-(3-bromofuran-2-yl)-N,2-dimethyl-2-phenylpropan-1-amine is CNC(c1occc1Br)C(C)(C)c1ccccc1.
What is the InChIKey of 1-(3-bromofuran-2-yl)-N,2-dimethyl-2-phenylpropan-1-amine?
The InChIKey is YNECLCPWIFDGAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18BrNO/c1-15(2,11-7-5-4-6-8-11)14(17-3)13-12(16)9-10-18-13/h4-10,14,17H,1-3H3.
What are the key properties of 1-(3-bromofuran-2-yl)-N,2-dimethyl-2-phenylpropan-1-amine?
1-(3-bromofuran-2-yl)-N,2-dimethyl-2-phenylpropan-1-amine has a molecular weight of 308.22 g/mol, XLogP of 4.28, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-bromofuran-2-yl)-N,2-dimethyl-2-phenylpropan-1-amine is sourced from PubChem (CID 63941875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).