C18H24N2O — CID 63942132
N,N-dimethyl-3-[3-[(propan-2-ylamino)methyl]phenoxy]aniline (PubChem CID 63942132) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is N,N-dimethyl-3-[3-[(propan-2-ylamino)methyl]phenoxy]aniline.
| Compound Name | N,N-dimethyl-3-[3-[(propan-2-ylamino)methyl]phenoxy]aniline |
|---|---|
| PubChem CID | 63942132 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | N,N-dimethyl-3-[3-[(propan-2-ylamino)methyl]phenoxy]aniline |
| SMILES | CC(C)NCc1cccc(Oc2cccc(N(C)C)c2)c1 |
| InChI | InChI=1S/C18H24N2O/c1-14(2)19-13-15-7-5-9-17(11-15)21-18-10-6-8-16(12-18)20(3)4/h5-12,14,19H,13H2,1-4H3 |
| InChIKey | VYUUVJOJPXFCGG-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |