C13H7Cl3O2 — CID 63942666
3-(2,4,5-trichlorophenoxy)benzaldehyde (PubChem CID 63942666) has the molecular formula C13H7Cl3O2 and a molecular weight of 301.56 g/mol. Its IUPAC name is 3-(2,4,5-trichlorophenoxy)benzaldehyde.
| Compound Name | 3-(2,4,5-trichlorophenoxy)benzaldehyde |
|---|---|
| PubChem CID | 63942666 |
| Molecular Formula | C13H7Cl3O2 |
| Molecular Weight | 301.56 g/mol |
| Exact Mass | 299.95 |
| IUPAC Name | 3-(2,4,5-trichlorophenoxy)benzaldehyde |
| SMILES | O=Cc1cccc(Oc2cc(Cl)c(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C13H7Cl3O2/c14-10-5-12(16)13(6-11(10)15)18-9-3-1-2-8(4-9)7-17/h1-7H |
| InChIKey | QXUHTRRCGRTAOP-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.56 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|