C13H15N3O4S — CID 63943347
5-[2-oxo-2-[(2-propan-2-ylpyrazol-3-yl)amino]ethyl]sulfanylfuran-2-carboxylic acid (PubChem CID 63943347) has the molecular formula C13H15N3O4S and a molecular weight of 309.35 g/mol. Its IUPAC name is 5-[2-oxo-2-[(2-propan-2-ylpyrazol-3-yl)amino]ethyl]sulfanylfuran-2-carboxylic acid.
| Compound Name | 5-[2-oxo-2-[(2-propan-2-ylpyrazol-3-yl)amino]ethyl]sulfanylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 63943347 |
| Molecular Formula | C13H15N3O4S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 5-[2-oxo-2-[(2-propan-2-ylpyrazol-3-yl)amino]ethyl]sulfanylfuran-2-carboxylic acid |
| SMILES | CC(C)n1nccc1NC(=O)CSc1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C13H15N3O4S/c1-8(2)16-10(5-6-14-16)15-11(17)7-21-12-4-3-9(20-12)13(18)19/h3-6,8H,7H2,1-2H3,(H,15,17)(H,18,19) |
| InChIKey | CAJHTQDJOUXGPO-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 97.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |