About 4-ethyl-2-fluoropyridine
4-ethyl-2-fluoropyridine (PubChem CID 639436) has the molecular formula C7H8FN
and a molecular weight of 125.15 g/mol. Its IUPAC name is 4-ethyl-2-fluoropyridine.
Molecular Properties
| Compound Name | 4-ethyl-2-fluoropyridine |
| PubChem CID | 639436 |
| Molecular Formula | C7H8FN |
| Molecular Weight | 125.15 g/mol |
| Exact Mass | 125.06 |
| IUPAC Name | 4-ethyl-2-fluoropyridine |
| SMILES | CCc1ccnc(F)c1 |
| InChI | InChI=1S/C7H8FN/c1-2-6-3-4-9-7(8)5-6/h3-5H,2H2,1H3 |
| InChIKey | ADUKLIOGUJGWMP-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.15 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-2-fluoropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-2-fluoropyridine?
The IUPAC name of 4-ethyl-2-fluoropyridine (CID 639436) is 4-ethyl-2-fluoropyridine.
What is the SMILES notation for 4-ethyl-2-fluoropyridine?
The canonical SMILES for 4-ethyl-2-fluoropyridine is CCc1ccnc(F)c1.
What is the InChIKey of 4-ethyl-2-fluoropyridine?
The InChIKey is ADUKLIOGUJGWMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8FN/c1-2-6-3-4-9-7(8)5-6/h3-5H,2H2,1H3.
What are the key properties of 4-ethyl-2-fluoropyridine?
4-ethyl-2-fluoropyridine has a molecular weight of 125.15 g/mol, XLogP of 1.78, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2-fluoropyridine is sourced from PubChem (CID 639436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).