C14H19NO6S — CID 6394374
diethyl (2Z)-2-(1-methoxy-1-oxopropan-2-ylidene)-3,6-dihydro-1,3-thiazine-5,6-dicarboxylate (PubChem CID 6394374) has the molecular formula C14H19NO6S and a molecular weight of 329.37 g/mol. Its IUPAC name is diethyl (2Z)-2-(1-methoxy-1-oxopropan-2-ylidene)-3,6-dihydro-1,3-thiazine-5,6-dicarboxylate.
| Compound Name | diethyl (2Z)-2-(1-methoxy-1-oxopropan-2-ylidene)-3,6-dihydro-1,3-thiazine-5,6-dicarboxylate |
|---|---|
| PubChem CID | 6394374 |
| Molecular Formula | C14H19NO6S |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | diethyl (2Z)-2-(1-methoxy-1-oxopropan-2-ylidene)-3,6-dihydro-1,3-thiazine-5,6-dicarboxylate |
| SMILES | CCOC(=O)C1=CN/C(=C(\C)C(=O)OC)SC1C(=O)OCC |
| InChI | InChI=1S/C14H19NO6S/c1-5-20-13(17)9-7-15-11(8(3)12(16)19-4)22-10(9)14(18)21-6-2/h7,10,15H,5-6H2,1-4H3/b11-8- |
| InChIKey | CDSGPNSMBUWSBF-FLIBITNWSA-N |
| XLogP | 1.11 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|