About 2-amino-N-[2-(3,5-difluorophenyl)ethyl]-4-methyl-1,3-thiazole-5-sulfonamide
2-amino-N-[2-(3,5-difluorophenyl)ethyl]-4-methyl-1,3-thiazole-5-sulfonamide (PubChem CID 63944835) has the molecular formula C12H13F2N3O2S2
and a molecular weight of 333.39 g/mol. Its IUPAC name is 2-amino-N-[2-(3,5-difluorophenyl)ethyl]-4-methyl-1,3-thiazole-5-sulfonamide.
Molecular Properties
| Compound Name | 2-amino-N-[2-(3,5-difluorophenyl)ethyl]-4-methyl-1,3-thiazole-5-sulfonamide |
| PubChem CID | 63944835 |
| Molecular Formula | C12H13F2N3O2S2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | 2-amino-N-[2-(3,5-difluorophenyl)ethyl]-4-methyl-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1nc(N)sc1S(=O)(=O)NCCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H13F2N3O2S2/c1-7-11(20-12(15)17-7)21(18,19)16-3-2-8-4-9(13)6-10(14)5-8/h4-6,16H,2-3H2,1H3,(H2,15,17) |
| InChIKey | SLBQQEDQOWMVNT-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-N-[2-(3,5-difluorophenyl)ethyl]-4-methyl-1,3-thiazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-[2-(3,5-difluorophenyl)ethyl]-4-methyl-1,3-thiazole-5-sulfonamide?
The IUPAC name of 2-amino-N-[2-(3,5-difluorophenyl)ethyl]-4-methyl-1,3-thiazole-5-sulfonamide (CID 63944835) is 2-amino-N-[2-(3,5-difluorophenyl)ethyl]-4-methyl-1,3-thiazole-5-sulfonamide.
What is the SMILES notation for 2-amino-N-[2-(3,5-difluorophenyl)ethyl]-4-methyl-1,3-thiazole-5-sulfonamide?
The canonical SMILES for 2-amino-N-[2-(3,5-difluorophenyl)ethyl]-4-methyl-1,3-thiazole-5-sulfonamide is Cc1nc(N)sc1S(=O)(=O)NCCc1cc(F)cc(F)c1.
What is the InChIKey of 2-amino-N-[2-(3,5-difluorophenyl)ethyl]-4-methyl-1,3-thiazole-5-sulfonamide?
The InChIKey is SLBQQEDQOWMVNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13F2N3O2S2/c1-7-11(20-12(15)17-7)21(18,19)16-3-2-8-4-9(13)6-10(14)5-8/h4-6,16H,2-3H2,1H3,(H2,15,17).
What are the key properties of 2-amino-N-[2-(3,5-difluorophenyl)ethyl]-4-methyl-1,3-thiazole-5-sulfonamide?
2-amino-N-[2-(3,5-difluorophenyl)ethyl]-4-methyl-1,3-thiazole-5-sulfonamide has a molecular weight of 333.39 g/mol, XLogP of 1.83, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-[2-(3,5-difluorophenyl)ethyl]-4-methyl-1,3-thiazole-5-sulfonamide is sourced from PubChem (CID 63944835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).