About 4-methyl-2-(1,3-thiazole-4-carbonylamino)-1,3-thiazole-5-sulfonyl chloride
4-methyl-2-(1,3-thiazole-4-carbonylamino)-1,3-thiazole-5-sulfonyl chloride (PubChem CID 63944847) has the molecular formula C8H6ClN3O3S3
and a molecular weight of 323.81 g/mol. Its IUPAC name is 4-methyl-2-(1,3-thiazole-4-carbonylamino)-1,3-thiazole-5-sulfonyl chloride.
Molecular Properties
| Compound Name | 4-methyl-2-(1,3-thiazole-4-carbonylamino)-1,3-thiazole-5-sulfonyl chloride |
| PubChem CID | 63944847 |
| Molecular Formula | C8H6ClN3O3S3 |
| Molecular Weight | 323.81 g/mol |
| Exact Mass | 322.93 |
| IUPAC Name | 4-methyl-2-(1,3-thiazole-4-carbonylamino)-1,3-thiazole-5-sulfonyl chloride |
| SMILES | Cc1nc(NC(=O)c2cscn2)sc1S(=O)(=O)Cl |
| InChI | InChI=1S/C8H6ClN3O3S3/c1-4-7(18(9,14)15)17-8(11-4)12-6(13)5-2-16-3-10-5/h2-3H,1H3,(H,11,12,13) |
| InChIKey | XVYNKTOBWUSWMV-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.81 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-methyl-2-(1,3-thiazole-4-carbonylamino)-1,3-thiazole-5-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-(1,3-thiazole-4-carbonylamino)-1,3-thiazole-5-sulfonyl chloride?
The IUPAC name of 4-methyl-2-(1,3-thiazole-4-carbonylamino)-1,3-thiazole-5-sulfonyl chloride (CID 63944847) is 4-methyl-2-(1,3-thiazole-4-carbonylamino)-1,3-thiazole-5-sulfonyl chloride.
What is the SMILES notation for 4-methyl-2-(1,3-thiazole-4-carbonylamino)-1,3-thiazole-5-sulfonyl chloride?
The canonical SMILES for 4-methyl-2-(1,3-thiazole-4-carbonylamino)-1,3-thiazole-5-sulfonyl chloride is Cc1nc(NC(=O)c2cscn2)sc1S(=O)(=O)Cl.
What is the InChIKey of 4-methyl-2-(1,3-thiazole-4-carbonylamino)-1,3-thiazole-5-sulfonyl chloride?
The InChIKey is XVYNKTOBWUSWMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClN3O3S3/c1-4-7(18(9,14)15)17-8(11-4)12-6(13)5-2-16-3-10-5/h2-3H,1H3,(H,11,12,13).
What are the key properties of 4-methyl-2-(1,3-thiazole-4-carbonylamino)-1,3-thiazole-5-sulfonyl chloride?
4-methyl-2-(1,3-thiazole-4-carbonylamino)-1,3-thiazole-5-sulfonyl chloride has a molecular weight of 323.81 g/mol, XLogP of 2.09, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-(1,3-thiazole-4-carbonylamino)-1,3-thiazole-5-sulfonyl chloride is sourced from PubChem (CID 63944847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).