About 2-amino-N-[(2-fluorophenyl)methyl]-N,4-dimethyl-1,3-thiazole-5-sulfonamide
2-amino-N-[(2-fluorophenyl)methyl]-N,4-dimethyl-1,3-thiazole-5-sulfonamide (PubChem CID 63945798) has the molecular formula C12H14FN3O2S2
and a molecular weight of 315.40 g/mol. Its IUPAC name is 2-amino-N-[(2-fluorophenyl)methyl]-N,4-dimethyl-1,3-thiazole-5-sulfonamide.
Molecular Properties
| Compound Name | 2-amino-N-[(2-fluorophenyl)methyl]-N,4-dimethyl-1,3-thiazole-5-sulfonamide |
| PubChem CID | 63945798 |
| Molecular Formula | C12H14FN3O2S2 |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 2-amino-N-[(2-fluorophenyl)methyl]-N,4-dimethyl-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1nc(N)sc1S(=O)(=O)N(C)Cc1ccccc1F |
| InChI | InChI=1S/C12H14FN3O2S2/c1-8-11(19-12(14)15-8)20(17,18)16(2)7-9-5-3-4-6-10(9)13/h3-6H,7H2,1-2H3,(H2,14,15) |
| InChIKey | LKXNHGSTVXARCS-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-N-[(2-fluorophenyl)methyl]-N,4-dimethyl-1,3-thiazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-[(2-fluorophenyl)methyl]-N,4-dimethyl-1,3-thiazole-5-sulfonamide?
The IUPAC name of 2-amino-N-[(2-fluorophenyl)methyl]-N,4-dimethyl-1,3-thiazole-5-sulfonamide (CID 63945798) is 2-amino-N-[(2-fluorophenyl)methyl]-N,4-dimethyl-1,3-thiazole-5-sulfonamide.
What is the SMILES notation for 2-amino-N-[(2-fluorophenyl)methyl]-N,4-dimethyl-1,3-thiazole-5-sulfonamide?
The canonical SMILES for 2-amino-N-[(2-fluorophenyl)methyl]-N,4-dimethyl-1,3-thiazole-5-sulfonamide is Cc1nc(N)sc1S(=O)(=O)N(C)Cc1ccccc1F.
What is the InChIKey of 2-amino-N-[(2-fluorophenyl)methyl]-N,4-dimethyl-1,3-thiazole-5-sulfonamide?
The InChIKey is LKXNHGSTVXARCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14FN3O2S2/c1-8-11(19-12(14)15-8)20(17,18)16(2)7-9-5-3-4-6-10(9)13/h3-6H,7H2,1-2H3,(H2,14,15).
What are the key properties of 2-amino-N-[(2-fluorophenyl)methyl]-N,4-dimethyl-1,3-thiazole-5-sulfonamide?
2-amino-N-[(2-fluorophenyl)methyl]-N,4-dimethyl-1,3-thiazole-5-sulfonamide has a molecular weight of 315.40 g/mol, XLogP of 1.99, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-[(2-fluorophenyl)methyl]-N,4-dimethyl-1,3-thiazole-5-sulfonamide is sourced from PubChem (CID 63945798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).