About 2-amino-N-(2,6-diethylphenyl)-4-methyl-1,3-thiazole-5-sulfonamide
2-amino-N-(2,6-diethylphenyl)-4-methyl-1,3-thiazole-5-sulfonamide (PubChem CID 63945975) has the molecular formula C14H19N3O2S2
and a molecular weight of 325.46 g/mol. Its IUPAC name is 2-amino-N-(2,6-diethylphenyl)-4-methyl-1,3-thiazole-5-sulfonamide.
Molecular Properties
| Compound Name | 2-amino-N-(2,6-diethylphenyl)-4-methyl-1,3-thiazole-5-sulfonamide |
| PubChem CID | 63945975 |
| Molecular Formula | C14H19N3O2S2 |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 2-amino-N-(2,6-diethylphenyl)-4-methyl-1,3-thiazole-5-sulfonamide |
| SMILES | CCc1cccc(CC)c1NS(=O)(=O)c1sc(N)nc1C |
| InChI | InChI=1S/C14H19N3O2S2/c1-4-10-7-6-8-11(5-2)12(10)17-21(18,19)13-9(3)16-14(15)20-13/h6-8,17H,4-5H2,1-3H3,(H2,15,16) |
| InChIKey | BRIGWXZILJWRII-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-N-(2,6-diethylphenyl)-4-methyl-1,3-thiazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-(2,6-diethylphenyl)-4-methyl-1,3-thiazole-5-sulfonamide?
The IUPAC name of 2-amino-N-(2,6-diethylphenyl)-4-methyl-1,3-thiazole-5-sulfonamide (CID 63945975) is 2-amino-N-(2,6-diethylphenyl)-4-methyl-1,3-thiazole-5-sulfonamide.
What is the SMILES notation for 2-amino-N-(2,6-diethylphenyl)-4-methyl-1,3-thiazole-5-sulfonamide?
The canonical SMILES for 2-amino-N-(2,6-diethylphenyl)-4-methyl-1,3-thiazole-5-sulfonamide is CCc1cccc(CC)c1NS(=O)(=O)c1sc(N)nc1C.
What is the InChIKey of 2-amino-N-(2,6-diethylphenyl)-4-methyl-1,3-thiazole-5-sulfonamide?
The InChIKey is BRIGWXZILJWRII-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3O2S2/c1-4-10-7-6-8-11(5-2)12(10)17-21(18,19)13-9(3)16-14(15)20-13/h6-8,17H,4-5H2,1-3H3,(H2,15,16).
What are the key properties of 2-amino-N-(2,6-diethylphenyl)-4-methyl-1,3-thiazole-5-sulfonamide?
2-amino-N-(2,6-diethylphenyl)-4-methyl-1,3-thiazole-5-sulfonamide has a molecular weight of 325.46 g/mol, XLogP of 2.96, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-(2,6-diethylphenyl)-4-methyl-1,3-thiazole-5-sulfonamide is sourced from PubChem (CID 63945975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).